C13H16FN5OS — CID 63538268
N-(2-amino-4-fluorophenyl)-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propanamide (PubChem CID 63538268) has the molecular formula C13H16FN5OS and a molecular weight of 309.37 g/mol. Its IUPAC name is N-(2-amino-4-fluorophenyl)-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propanamide.
| Compound Name | N-(2-amino-4-fluorophenyl)-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 63538268 |
| Molecular Formula | C13H16FN5OS |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | N-(2-amino-4-fluorophenyl)-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
| SMILES | Cc1nnc(SC(C)C(=O)Nc2ccc(F)cc2N)n1C |
| InChI | InChI=1S/C13H16FN5OS/c1-7(21-13-18-17-8(2)19(13)3)12(20)16-11-5-4-9(14)6-10(11)15/h4-7H,15H2,1-3H3,(H,16,20) |
| InChIKey | OBVKXXKAVGIVJU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|