C15H21N3O3S — CID 29196301
2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylamino]-N-pentylacetamide (PubChem CID 29196301) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylamino]-N-pentylacetamide.
| Compound Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylamino]-N-pentylacetamide |
|---|---|
| PubChem CID | 29196301 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 2-[(1,1-dioxo-1,2-benzothiazol-3-yl)-methylamino]-N-pentylacetamide |
| SMILES | CCCCCNC(=O)CN(C)C1=NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C15H21N3O3S/c1-3-4-7-10-16-14(19)11-18(2)15-12-8-5-6-9-13(12)22(20,21)17-15/h5-6,8-9H,3-4,7,10-11H2,1-2H3,(H,16,19) |
| InChIKey | GNLXONGMGMISTK-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|