C24H27NO2 — CID 2920414
N-[(1-hydroxynaphthalen-2-yl)-(4-propan-2-ylphenyl)methyl]-2-methylpropanamide (PubChem CID 2920414) has the molecular formula C24H27NO2 and a molecular weight of 361.49 g/mol. Its IUPAC name is N-[(1-hydroxynaphthalen-2-yl)-(4-propan-2-ylphenyl)methyl]-2-methylpropanamide.
| Compound Name | N-[(1-hydroxynaphthalen-2-yl)-(4-propan-2-ylphenyl)methyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 2920414 |
| Molecular Formula | C24H27NO2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | N-[(1-hydroxynaphthalen-2-yl)-(4-propan-2-ylphenyl)methyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NC(c1ccc(C(C)C)cc1)c1ccc2ccccc2c1O |
| InChI | InChI=1S/C24H27NO2/c1-15(2)17-9-11-19(12-10-17)22(25-24(27)16(3)4)21-14-13-18-7-5-6-8-20(18)23(21)26/h5-16,22,26H,1-4H3,(H,25,27) |
| InChIKey | IDSZEOVUYLOAOW-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|