C21H35ClN2O — CID 2921477
2-(dipropylamino)-N-[(1-phenylcyclopentyl)methyl]propanamide;hydrochloride (PubChem CID 2921477) has the molecular formula C21H35ClN2O and a molecular weight of 366.98 g/mol. Its IUPAC name is 2-(dipropylamino)-N-[(1-phenylcyclopentyl)methyl]propanamide;hydrochloride.
| Compound Name | 2-(dipropylamino)-N-[(1-phenylcyclopentyl)methyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 2921477 |
| Molecular Formula | C21H35ClN2O |
| Molecular Weight | 366.98 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 2-(dipropylamino)-N-[(1-phenylcyclopentyl)methyl]propanamide;hydrochloride |
| SMILES | CCCN(CCC)C(C)C(=O)NCC1(c2ccccc2)CCCC1.Cl |
| InChI | InChI=1S/C21H34N2O.ClH/c1-4-15-23(16-5-2)18(3)20(24)22-17-21(13-9-10-14-21)19-11-7-6-8-12-19;/h6-8,11-12,18H,4-5,9-10,13-17H2,1-3H3,(H,22,24);1H |
| InChIKey | WBDGRCCIHSGSML-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.98 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |