C18H22N2O5 — CID 2923042
oxalic acid;1-[4-(2-prop-2-enylphenoxy)butyl]imidazole (PubChem CID 2923042) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is oxalic acid;1-[4-(2-prop-2-enylphenoxy)butyl]imidazole.
| Compound Name | oxalic acid;1-[4-(2-prop-2-enylphenoxy)butyl]imidazole |
|---|---|
| PubChem CID | 2923042 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | oxalic acid;1-[4-(2-prop-2-enylphenoxy)butyl]imidazole |
| SMILES | C=CCc1ccccc1OCCCCn1ccnc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H20N2O.C2H2O4/c1-2-7-15-8-3-4-9-16(15)19-13-6-5-11-18-12-10-17-14-18;3-1(4)2(5)6/h2-4,8-10,12,14H,1,5-7,11,13H2;(H,3,4)(H,5,6) |
| InChIKey | SKYHXPCZBPXNPD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|