C20H27N3O4 — CID 138384911
4-[[2-(4-imidazol-1-ylbutoxy)phenyl]methyl]-1,4-oxazepane-6-carboxylic acid (PubChem CID 138384911) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is 4-[[2-(4-imidazol-1-ylbutoxy)phenyl]methyl]-1,4-oxazepane-6-carboxylic acid.
| Compound Name | 4-[[2-(4-imidazol-1-ylbutoxy)phenyl]methyl]-1,4-oxazepane-6-carboxylic acid |
|---|---|
| PubChem CID | 138384911 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 4-[[2-(4-imidazol-1-ylbutoxy)phenyl]methyl]-1,4-oxazepane-6-carboxylic acid |
| SMILES | O=C(O)C1COCCN(Cc2ccccc2OCCCCn2ccnc2)C1 |
| InChI | InChI=1S/C20H27N3O4/c24-20(25)18-14-23(10-12-26-15-18)13-17-5-1-2-6-19(17)27-11-4-3-8-22-9-7-21-16-22/h1-2,5-7,9,16,18H,3-4,8,10-15H2,(H,24,25) |
| InChIKey | JYTBSSIYODUGQG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|