C21H30N4O2 — CID 77080171
1-[[2-(2-imidazol-1-ylethoxy)phenyl]methyl]-4-(oxan-4-yl)piperazine (PubChem CID 77080171) has the molecular formula C21H30N4O2 and a molecular weight of 370.50 g/mol. Its IUPAC name is 1-[[2-(2-imidazol-1-ylethoxy)phenyl]methyl]-4-(oxan-4-yl)piperazine.
| Compound Name | 1-[[2-(2-imidazol-1-ylethoxy)phenyl]methyl]-4-(oxan-4-yl)piperazine |
|---|---|
| PubChem CID | 77080171 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 1-[[2-(2-imidazol-1-ylethoxy)phenyl]methyl]-4-(oxan-4-yl)piperazine |
| SMILES | c1ccc(OCCn2ccnc2)c(CN2CCN(C3CCOCC3)CC2)c1 |
| InChI | InChI=1S/C21H30N4O2/c1-2-4-21(27-16-13-24-8-7-22-18-24)19(3-1)17-23-9-11-25(12-10-23)20-5-14-26-15-6-20/h1-4,7-8,18,20H,5-6,9-17H2 |
| InChIKey | MGYORLCNMLHOLE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 42.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |