C23H35N3O3 — CID 155911930
(3R,4R)-4-(hydroxymethyl)-1-[[2-(4-imidazol-1-ylbutoxy)phenyl]methyl]-4-propylpiperidin-3-ol (PubChem CID 155911930) has the molecular formula C23H35N3O3 and a molecular weight of 401.55 g/mol. Its IUPAC name is (3R,4R)-4-(hydroxymethyl)-1-[[2-(4-imidazol-1-ylbutoxy)phenyl]methyl]-4-propylpiperidin-3-ol.
| Compound Name | (3R,4R)-4-(hydroxymethyl)-1-[[2-(4-imidazol-1-ylbutoxy)phenyl]methyl]-4-propylpiperidin-3-ol |
|---|---|
| PubChem CID | 155911930 |
| Molecular Formula | C23H35N3O3 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.27 |
| IUPAC Name | (3R,4R)-4-(hydroxymethyl)-1-[[2-(4-imidazol-1-ylbutoxy)phenyl]methyl]-4-propylpiperidin-3-ol |
| SMILES | CCC[C@]1(CO)CCN(Cc2ccccc2OCCCCn2ccnc2)C[C@@H]1O |
| InChI | InChI=1S/C23H35N3O3/c1-2-9-23(18-27)10-13-26(17-22(23)28)16-20-7-3-4-8-21(20)29-15-6-5-12-25-14-11-24-19-25/h3-4,7-8,11,14,19,22,27-28H,2,5-6,9-10,12-13,15-18H2,1H3/t22-,23+/m0/s1 |
| InChIKey | NDABDBSFOFWZCR-XZOQPEGZSA-N |
| XLogP | 3.09 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|