C19H26ClN3O3 — CID 56883721
(3S,4R)-1-[[5-chloro-2-(3-imidazol-1-ylpropoxy)phenyl]methyl]-4-(hydroxymethyl)piperidin-3-ol (PubChem CID 56883721) has the molecular formula C19H26ClN3O3 and a molecular weight of 379.89 g/mol. Its IUPAC name is (3S,4R)-1-[[5-chloro-2-(3-imidazol-1-ylpropoxy)phenyl]methyl]-4-(hydroxymethyl)piperidin-3-ol.
| Compound Name | (3S,4R)-1-[[5-chloro-2-(3-imidazol-1-ylpropoxy)phenyl]methyl]-4-(hydroxymethyl)piperidin-3-ol |
|---|---|
| PubChem CID | 56883721 |
| Molecular Formula | C19H26ClN3O3 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | (3S,4R)-1-[[5-chloro-2-(3-imidazol-1-ylpropoxy)phenyl]methyl]-4-(hydroxymethyl)piperidin-3-ol |
| SMILES | OC[C@H]1CCN(Cc2cc(Cl)ccc2OCCCn2ccnc2)C[C@H]1O |
| InChI | InChI=1S/C19H26ClN3O3/c20-17-2-3-19(26-9-1-6-22-8-5-21-14-22)16(10-17)11-23-7-4-15(13-24)18(25)12-23/h2-3,5,8,10,14-15,18,24-25H,1,4,6-7,9,11-13H2/t15-,18-/m1/s1 |
| InChIKey | RQKBQRPYSFCZDA-CRAIPNDOSA-N |
| XLogP | 2.18 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|