C19H25FN2O2S2 — CID 29237994
N-[(2R)-2-(azepan-1-yl)-2-thiophen-3-ylethyl]-1-(4-fluorophenyl)methanesulfonamide (PubChem CID 29237994) has the molecular formula C19H25FN2O2S2 and a molecular weight of 396.55 g/mol. Its IUPAC name is N-[(2R)-2-(azepan-1-yl)-2-thiophen-3-ylethyl]-1-(4-fluorophenyl)methanesulfonamide.
| Compound Name | N-[(2R)-2-(azepan-1-yl)-2-thiophen-3-ylethyl]-1-(4-fluorophenyl)methanesulfonamide |
|---|---|
| PubChem CID | 29237994 |
| Molecular Formula | C19H25FN2O2S2 |
| Molecular Weight | 396.55 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | N-[(2R)-2-(azepan-1-yl)-2-thiophen-3-ylethyl]-1-(4-fluorophenyl)methanesulfonamide |
| SMILES | O=S(=O)(Cc1ccc(F)cc1)NC[C@@H](c1ccsc1)N1CCCCCC1 |
| InChI | InChI=1S/C19H25FN2O2S2/c20-18-7-5-16(6-8-18)15-26(23,24)21-13-19(17-9-12-25-14-17)22-10-3-1-2-4-11-22/h5-9,12,14,19,21H,1-4,10-11,13,15H2/t19-/m0/s1 |
| InChIKey | QFTSYIPUHRSMSG-IBGZPJMESA-N |
| XLogP | 3.92 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |