C16H17N3 — CID 29247572
2-[(2S)-2-(1H-benzimidazol-2-yl)propyl]aniline (PubChem CID 29247572) has the molecular formula C16H17N3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-[(2S)-2-(1H-benzimidazol-2-yl)propyl]aniline.
| Compound Name | 2-[(2S)-2-(1H-benzimidazol-2-yl)propyl]aniline |
|---|---|
| PubChem CID | 29247572 |
| Molecular Formula | C16H17N3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 2-[(2S)-2-(1H-benzimidazol-2-yl)propyl]aniline |
| SMILES | C[C@@H](Cc1ccccc1N)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H17N3/c1-11(10-12-6-2-3-7-13(12)17)16-18-14-8-4-5-9-15(14)19-16/h2-9,11H,10,17H2,1H3,(H,18,19)/t11-/m0/s1 |
| InChIKey | LIXHIFFGOSDVRL-NSHDSACASA-N |
| XLogP | 3.49 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|