C15H13ClN4O3S — CID 29247844
(5-chlorothiadiazol-4-yl)methyl 1-ethyl-3-methyl-2-oxoquinoxaline-6-carboxylate (PubChem CID 29247844) has the molecular formula C15H13ClN4O3S and a molecular weight of 364.81 g/mol. Its IUPAC name is (5-chlorothiadiazol-4-yl)methyl 1-ethyl-3-methyl-2-oxoquinoxaline-6-carboxylate.
| Compound Name | (5-chlorothiadiazol-4-yl)methyl 1-ethyl-3-methyl-2-oxoquinoxaline-6-carboxylate |
|---|---|
| PubChem CID | 29247844 |
| Molecular Formula | C15H13ClN4O3S |
| Molecular Weight | 364.81 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | (5-chlorothiadiazol-4-yl)methyl 1-ethyl-3-methyl-2-oxoquinoxaline-6-carboxylate |
| SMILES | CCn1c(=O)c(C)nc2cc(C(=O)OCc3nnsc3Cl)ccc21 |
| InChI | InChI=1S/C15H13ClN4O3S/c1-3-20-12-5-4-9(6-10(12)17-8(2)14(20)21)15(22)23-7-11-13(16)24-19-18-11/h4-6H,3,7H2,1-2H3 |
| InChIKey | SVIZXNBQVICZDC-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.81 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |