C25H32N2O — CID 29259211
[1-[(3R)-1-(9H-fluoren-2-ylmethyl)piperidin-3-yl]piperidin-4-yl]methanol (PubChem CID 29259211) has the molecular formula C25H32N2O and a molecular weight of 376.54 g/mol. Its IUPAC name is [1-[(3R)-1-(9H-fluoren-2-ylmethyl)piperidin-3-yl]piperidin-4-yl]methanol.
| Compound Name | [1-[(3R)-1-(9H-fluoren-2-ylmethyl)piperidin-3-yl]piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 29259211 |
| Molecular Formula | C25H32N2O |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | [1-[(3R)-1-(9H-fluoren-2-ylmethyl)piperidin-3-yl]piperidin-4-yl]methanol |
| SMILES | OCC1CCN([C@@H]2CCCN(Cc3ccc4c(c3)Cc3ccccc3-4)C2)CC1 |
| InChI | InChI=1S/C25H32N2O/c28-18-19-9-12-27(13-10-19)23-5-3-11-26(17-23)16-20-7-8-25-22(14-20)15-21-4-1-2-6-24(21)25/h1-2,4,6-8,14,19,23,28H,3,5,9-13,15-18H2/t23-/m1/s1 |
| InChIKey | JCJHDNPOAMJSEM-HSZRJFAPSA-N |
| XLogP | 3.93 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |