C23H25N3O2S — CID 2927327
N-(4-methoxyphenyl)-6-methyl-2-(pyridin-3-ylmethylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 2927327) has the molecular formula C23H25N3O2S and a molecular weight of 407.54 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-6-methyl-2-(pyridin-3-ylmethylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-(4-methoxyphenyl)-6-methyl-2-(pyridin-3-ylmethylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 2927327 |
| Molecular Formula | C23H25N3O2S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | N-(4-methoxyphenyl)-6-methyl-2-(pyridin-3-ylmethylamino)-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2c(NCc3cccnc3)sc3c2CCC(C)C3)cc1 |
| InChI | InChI=1S/C23H25N3O2S/c1-15-5-10-19-20(12-15)29-23(25-14-16-4-3-11-24-13-16)21(19)22(27)26-17-6-8-18(28-2)9-7-17/h3-4,6-9,11,13,15,25H,5,10,12,14H2,1-2H3,(H,26,27) |
| InChIKey | PRCAPKYBQBBSCS-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_H(2)', 'substructure': 'N/A'} |
|---|