About 2-[5-[2-(4-hydroxyphenyl)ethenyl]-2-phenyl-1,2,4-triazol-3-yl]phenol
2-[5-[2-(4-hydroxyphenyl)ethenyl]-2-phenyl-1,2,4-triazol-3-yl]phenol (PubChem CID 2928775) has the molecular formula C22H17N3O2
and a molecular weight of 355.40 g/mol. Its IUPAC name is 2-[5-[2-(4-hydroxyphenyl)ethenyl]-2-phenyl-1,2,4-triazol-3-yl]phenol.
Molecular Properties
| Compound Name | 2-[5-[2-(4-hydroxyphenyl)ethenyl]-2-phenyl-1,2,4-triazol-3-yl]phenol |
| PubChem CID | 2928775 |
| Molecular Formula | C22H17N3O2 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 2-[5-[2-(4-hydroxyphenyl)ethenyl]-2-phenyl-1,2,4-triazol-3-yl]phenol |
| SMILES | Oc1ccc(C=Cc2nc(-c3ccccc3O)n(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C22H17N3O2/c26-18-13-10-16(11-14-18)12-15-21-23-22(19-8-4-5-9-20(19)27)25(24-21)17-6-2-1-3-7-17/h1-15,26-27H |
| InChIKey | URSCGRASVSZIBN-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[5-[2-(4-hydroxyphenyl)ethenyl]-2-phenyl-1,2,4-triazol-3-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-[2-(4-hydroxyphenyl)ethenyl]-2-phenyl-1,2,4-triazol-3-yl]phenol?
The IUPAC name of 2-[5-[2-(4-hydroxyphenyl)ethenyl]-2-phenyl-1,2,4-triazol-3-yl]phenol (CID 2928775) is 2-[5-[2-(4-hydroxyphenyl)ethenyl]-2-phenyl-1,2,4-triazol-3-yl]phenol.
What is the SMILES notation for 2-[5-[2-(4-hydroxyphenyl)ethenyl]-2-phenyl-1,2,4-triazol-3-yl]phenol?
The canonical SMILES for 2-[5-[2-(4-hydroxyphenyl)ethenyl]-2-phenyl-1,2,4-triazol-3-yl]phenol is Oc1ccc(C=Cc2nc(-c3ccccc3O)n(-c3ccccc3)n2)cc1.
What is the InChIKey of 2-[5-[2-(4-hydroxyphenyl)ethenyl]-2-phenyl-1,2,4-triazol-3-yl]phenol?
The InChIKey is URSCGRASVSZIBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17N3O2/c26-18-13-10-16(11-14-18)12-15-21-23-22(19-8-4-5-9-20(19)27)25(24-21)17-6-2-1-3-7-17/h1-15,26-27H.
What are the key properties of 2-[5-[2-(4-hydroxyphenyl)ethenyl]-2-phenyl-1,2,4-triazol-3-yl]phenol?
2-[5-[2-(4-hydroxyphenyl)ethenyl]-2-phenyl-1,2,4-triazol-3-yl]phenol has a molecular weight of 355.40 g/mol, XLogP of 4.52, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[2-(4-hydroxyphenyl)ethenyl]-2-phenyl-1,2,4-triazol-3-yl]phenol is sourced from PubChem (CID 2928775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).