C21H25ClN4O2 — CID 29292177
(3R)-3-(carbamoylamino)-3-(4-chlorophenyl)-N-(2-piperidin-1-ylphenyl)propanamide (PubChem CID 29292177) has the molecular formula C21H25ClN4O2 and a molecular weight of 400.91 g/mol. Its IUPAC name is (3R)-3-(carbamoylamino)-3-(4-chlorophenyl)-N-(2-piperidin-1-ylphenyl)propanamide.
| Compound Name | (3R)-3-(carbamoylamino)-3-(4-chlorophenyl)-N-(2-piperidin-1-ylphenyl)propanamide |
|---|---|
| PubChem CID | 29292177 |
| Molecular Formula | C21H25ClN4O2 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | (3R)-3-(carbamoylamino)-3-(4-chlorophenyl)-N-(2-piperidin-1-ylphenyl)propanamide |
| SMILES | NC(=O)N[C@H](CC(=O)Nc1ccccc1N1CCCCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H25ClN4O2/c22-16-10-8-15(9-11-16)18(25-21(23)28)14-20(27)24-17-6-2-3-7-19(17)26-12-4-1-5-13-26/h2-3,6-11,18H,1,4-5,12-14H2,(H,24,27)(H3,23,25,28)/t18-/m1/s1 |
| InChIKey | QZKVBPUENZZTHC-GOSISDBHSA-N |
| XLogP | 4.07 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |