C14H16ClN5O2 — CID 32603960
(3R)-3-(carbamoylamino)-3-(4-chlorophenyl)-N-(1-methylpyrazol-4-yl)propanamide (PubChem CID 32603960) has the molecular formula C14H16ClN5O2 and a molecular weight of 321.77 g/mol. Its IUPAC name is (3R)-3-(carbamoylamino)-3-(4-chlorophenyl)-N-(1-methylpyrazol-4-yl)propanamide.
| Compound Name | (3R)-3-(carbamoylamino)-3-(4-chlorophenyl)-N-(1-methylpyrazol-4-yl)propanamide |
|---|---|
| PubChem CID | 32603960 |
| Molecular Formula | C14H16ClN5O2 |
| Molecular Weight | 321.77 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | (3R)-3-(carbamoylamino)-3-(4-chlorophenyl)-N-(1-methylpyrazol-4-yl)propanamide |
| SMILES | Cn1cc(NC(=O)C[C@@H](NC(N)=O)c2ccc(Cl)cc2)cn1 |
| InChI | InChI=1S/C14H16ClN5O2/c1-20-8-11(7-17-20)18-13(21)6-12(19-14(16)22)9-2-4-10(15)5-3-9/h2-5,7-8,12H,6H2,1H3,(H,18,21)(H3,16,19,22)/t12-/m1/s1 |
| InChIKey | QKYASNYJRBMKLI-GFCCVEGCSA-N |
| XLogP | 1.81 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.77 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |