C17H14Cl2F3N3O2 — CID 4869879
3-(carbamoylamino)-3-(4-chlorophenyl)-N-[4-chloro-3-(trifluoromethyl)phenyl]propanamide (PubChem CID 4869879) has the molecular formula C17H14Cl2F3N3O2 and a molecular weight of 420.22 g/mol. Its IUPAC name is 3-(carbamoylamino)-3-(4-chlorophenyl)-N-[4-chloro-3-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 3-(carbamoylamino)-3-(4-chlorophenyl)-N-[4-chloro-3-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 4869879 |
| Molecular Formula | C17H14Cl2F3N3O2 |
| Molecular Weight | 420.22 g/mol |
| Exact Mass | 419.04 |
| IUPAC Name | 3-(carbamoylamino)-3-(4-chlorophenyl)-N-[4-chloro-3-(trifluoromethyl)phenyl]propanamide |
| SMILES | NC(=O)NC(CC(=O)Nc1ccc(Cl)c(C(F)(F)F)c1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H14Cl2F3N3O2/c18-10-3-1-9(2-4-10)14(25-16(23)27)8-15(26)24-11-5-6-13(19)12(7-11)17(20,21)22/h1-7,14H,8H2,(H,24,26)(H3,23,25,27) |
| InChIKey | BFNTVBXIWJFRQH-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.22 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |