C17H17BrFN3O2 — CID 51727191
(3R)-3-(4-bromophenyl)-3-(carbamoylamino)-N-(3-fluoro-4-methylphenyl)propanamide (PubChem CID 51727191) has the molecular formula C17H17BrFN3O2 and a molecular weight of 394.24 g/mol. Its IUPAC name is (3R)-3-(4-bromophenyl)-3-(carbamoylamino)-N-(3-fluoro-4-methylphenyl)propanamide.
| Compound Name | (3R)-3-(4-bromophenyl)-3-(carbamoylamino)-N-(3-fluoro-4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 51727191 |
| Molecular Formula | C17H17BrFN3O2 |
| Molecular Weight | 394.24 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | (3R)-3-(4-bromophenyl)-3-(carbamoylamino)-N-(3-fluoro-4-methylphenyl)propanamide |
| SMILES | Cc1ccc(NC(=O)C[C@@H](NC(N)=O)c2ccc(Br)cc2)cc1F |
| InChI | InChI=1S/C17H17BrFN3O2/c1-10-2-7-13(8-14(10)19)21-16(23)9-15(22-17(20)24)11-3-5-12(18)6-4-11/h2-8,15H,9H2,1H3,(H,21,23)(H3,20,22,24)/t15-/m1/s1 |
| InChIKey | YSOBCOZAFOBDQJ-OAHLLOKOSA-N |
| XLogP | 3.63 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.24 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |