C15H11Cl2F3N2O3S — CID 126151161
2-[(4-chlorophenyl)sulfonylamino]-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide (PubChem CID 126151161) has the molecular formula C15H11Cl2F3N2O3S and a molecular weight of 427.23 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonylamino]-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonylamino]-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 126151161 |
| Molecular Formula | C15H11Cl2F3N2O3S |
| Molecular Weight | 427.23 g/mol |
| Exact Mass | 425.98 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonylamino]-N-[4-chloro-3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CNS(=O)(=O)c1ccc(Cl)cc1)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H11Cl2F3N2O3S/c16-9-1-4-11(5-2-9)26(24,25)21-8-14(23)22-10-3-6-13(17)12(7-10)15(18,19)20/h1-7,21H,8H2,(H,22,23) |
| InChIKey | QIVVRNVACAADFJ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.23 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |