C17H19N3O2 — CID 29303584
N-[3-(1H-benzimidazol-2-yl)propyl]-3-(furan-2-yl)propanamide (PubChem CID 29303584) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is N-[3-(1H-benzimidazol-2-yl)propyl]-3-(furan-2-yl)propanamide.
| Compound Name | N-[3-(1H-benzimidazol-2-yl)propyl]-3-(furan-2-yl)propanamide |
|---|---|
| PubChem CID | 29303584 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-[3-(1H-benzimidazol-2-yl)propyl]-3-(furan-2-yl)propanamide |
| SMILES | O=C(CCc1ccco1)NCCCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C17H19N3O2/c21-17(10-9-13-5-4-12-22-13)18-11-3-8-16-19-14-6-1-2-7-15(14)20-16/h1-2,4-7,12H,3,8-11H2,(H,18,21)(H,19,20) |
| InChIKey | JERYJZCRHKXZQX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|