C16H17N3OS — CID 17417855
N-[2-(1H-benzimidazol-2-yl)ethyl]-3-thiophen-2-ylpropanamide (PubChem CID 17417855) has the molecular formula C16H17N3OS and a molecular weight of 299.40 g/mol. Its IUPAC name is N-[2-(1H-benzimidazol-2-yl)ethyl]-3-thiophen-2-ylpropanamide.
| Compound Name | N-[2-(1H-benzimidazol-2-yl)ethyl]-3-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 17417855 |
| Molecular Formula | C16H17N3OS |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | N-[2-(1H-benzimidazol-2-yl)ethyl]-3-thiophen-2-ylpropanamide |
| SMILES | O=C(CCc1cccs1)NCCc1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H17N3OS/c20-16(8-7-12-4-3-11-21-12)17-10-9-15-18-13-5-1-2-6-14(13)19-15/h1-6,11H,7-10H2,(H,17,20)(H,18,19) |
| InChIKey | KWWYJRCPWGKFHB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |