C18H21N3OS2 — CID 46411184
4-(1H-benzimidazol-2-yl)-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]butanamide (PubChem CID 46411184) has the molecular formula C18H21N3OS2 and a molecular weight of 359.52 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-yl)-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]butanamide.
| Compound Name | 4-(1H-benzimidazol-2-yl)-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]butanamide |
|---|---|
| PubChem CID | 46411184 |
| Molecular Formula | C18H21N3OS2 |
| Molecular Weight | 359.52 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 4-(1H-benzimidazol-2-yl)-N-[2-(thiophen-2-ylmethylsulfanyl)ethyl]butanamide |
| SMILES | O=C(CCCc1nc2ccccc2[nH]1)NCCSCc1cccs1 |
| InChI | InChI=1S/C18H21N3OS2/c22-18(19-10-12-23-13-14-5-4-11-24-14)9-3-8-17-20-15-6-1-2-7-16(15)21-17/h1-2,4-7,11H,3,8-10,12-13H2,(H,19,22)(H,20,21) |
| InChIKey | LDNUOQAPAMTBET-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.52 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|