C18H36N2O2S — CID 2932343
3-[3-(dipropylamino)-3-oxopropyl]sulfanyl-N,N-dipropylpropanamide (PubChem CID 2932343) has the molecular formula C18H36N2O2S and a molecular weight of 344.57 g/mol. Its IUPAC name is 3-[3-(dipropylamino)-3-oxopropyl]sulfanyl-N,N-dipropylpropanamide.
| Compound Name | 3-[3-(dipropylamino)-3-oxopropyl]sulfanyl-N,N-dipropylpropanamide |
|---|---|
| PubChem CID | 2932343 |
| Molecular Formula | C18H36N2O2S |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | 3-[3-(dipropylamino)-3-oxopropyl]sulfanyl-N,N-dipropylpropanamide |
| SMILES | CCCN(CCC)C(=O)CCSCCC(=O)N(CCC)CCC |
| InChI | InChI=1S/C18H36N2O2S/c1-5-11-19(12-6-2)17(21)9-15-23-16-10-18(22)20(13-7-3)14-8-4/h5-16H2,1-4H3 |
| InChIKey | KRYUTYRBUPYMMJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|