C16H24F4N2O2 — CID 2933321
2,2,3,3-tetrafluoro-1,4-bis(3-methylpiperidin-1-yl)butane-1,4-dione (PubChem CID 2933321) has the molecular formula C16H24F4N2O2 and a molecular weight of 352.37 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-1,4-bis(3-methylpiperidin-1-yl)butane-1,4-dione.
| Compound Name | 2,2,3,3-tetrafluoro-1,4-bis(3-methylpiperidin-1-yl)butane-1,4-dione |
|---|---|
| PubChem CID | 2933321 |
| Molecular Formula | C16H24F4N2O2 |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 2,2,3,3-tetrafluoro-1,4-bis(3-methylpiperidin-1-yl)butane-1,4-dione |
| SMILES | CC1CCCN(C(=O)C(F)(F)C(F)(F)C(=O)N2CCCC(C)C2)C1 |
| InChI | InChI=1S/C16H24F4N2O2/c1-11-5-3-7-21(9-11)13(23)15(17,18)16(19,20)14(24)22-8-4-6-12(2)10-22/h11-12H,3-10H2,1-2H3 |
| InChIKey | MTWNAIPUXJTKCG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|