C18H16N2OS2 — CID 2933601
1-methyl-5-[(4-methylsulfanylphenyl)methylidene]-3-phenyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 2933601) has the molecular formula C18H16N2OS2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 1-methyl-5-[(4-methylsulfanylphenyl)methylidene]-3-phenyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 1-methyl-5-[(4-methylsulfanylphenyl)methylidene]-3-phenyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 2933601 |
| Molecular Formula | C18H16N2OS2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | 1-methyl-5-[(4-methylsulfanylphenyl)methylidene]-3-phenyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | CSc1ccc(C=C2C(=O)N(c3ccccc3)C(=S)N2C)cc1 |
| InChI | InChI=1S/C18H16N2OS2/c1-19-16(12-13-8-10-15(23-2)11-9-13)17(21)20(18(19)22)14-6-4-3-5-7-14/h3-12H,1-2H3 |
| InChIKey | IMYVHPGNOBSGAI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|