C21H23N5O3 — CID 29343456
N-[(2R)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-(1-methylpyrrol-2-yl)ethyl]-N'-(1,2-oxazol-3-yl)oxamide (PubChem CID 29343456) has the molecular formula C21H23N5O3 and a molecular weight of 393.45 g/mol. Its IUPAC name is N-[(2R)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-(1-methylpyrrol-2-yl)ethyl]-N'-(1,2-oxazol-3-yl)oxamide.
| Compound Name | N-[(2R)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-(1-methylpyrrol-2-yl)ethyl]-N'-(1,2-oxazol-3-yl)oxamide |
|---|---|
| PubChem CID | 29343456 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | N-[(2R)-2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-(1-methylpyrrol-2-yl)ethyl]-N'-(1,2-oxazol-3-yl)oxamide |
| SMILES | Cn1cccc1[C@@H](CNC(=O)C(=O)Nc1ccon1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C21H23N5O3/c1-25-10-4-7-17(25)18(26-11-8-15-5-2-3-6-16(15)14-26)13-22-20(27)21(28)23-19-9-12-29-24-19/h2-7,9-10,12,18H,8,11,13-14H2,1H3,(H,22,27)(H,23,24,28)/t18-/m1/s1 |
| InChIKey | JEQFRGKOECOMSR-GOSISDBHSA-N |
| XLogP | 1.87 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|