C21H28N4O5 — CID 29343773
N'-(2,4-dimethoxyphenyl)-N-[(2R)-2-(1-methylpyrrol-2-yl)-2-morpholin-4-ylethyl]oxamide (PubChem CID 29343773) has the molecular formula C21H28N4O5 and a molecular weight of 416.48 g/mol. Its IUPAC name is N'-(2,4-dimethoxyphenyl)-N-[(2R)-2-(1-methylpyrrol-2-yl)-2-morpholin-4-ylethyl]oxamide.
| Compound Name | N'-(2,4-dimethoxyphenyl)-N-[(2R)-2-(1-methylpyrrol-2-yl)-2-morpholin-4-ylethyl]oxamide |
|---|---|
| PubChem CID | 29343773 |
| Molecular Formula | C21H28N4O5 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | N'-(2,4-dimethoxyphenyl)-N-[(2R)-2-(1-methylpyrrol-2-yl)-2-morpholin-4-ylethyl]oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)NC[C@H](c2cccn2C)N2CCOCC2)c(OC)c1 |
| InChI | InChI=1S/C21H28N4O5/c1-24-8-4-5-17(24)18(25-9-11-30-12-10-25)14-22-20(26)21(27)23-16-7-6-15(28-2)13-19(16)29-3/h4-8,13,18H,9-12,14H2,1-3H3,(H,22,26)(H,23,27)/t18-/m1/s1 |
| InChIKey | VBPVWRBZQHKZKX-GOSISDBHSA-N |
| XLogP | 1.17 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|