C25H27N3O4 — CID 16813231
N'-(2-methoxyphenyl)-N-(2-morpholin-4-yl-2-naphthalen-1-ylethyl)oxamide (PubChem CID 16813231) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is N'-(2-methoxyphenyl)-N-(2-morpholin-4-yl-2-naphthalen-1-ylethyl)oxamide.
| Compound Name | N'-(2-methoxyphenyl)-N-(2-morpholin-4-yl-2-naphthalen-1-ylethyl)oxamide |
|---|---|
| PubChem CID | 16813231 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | N'-(2-methoxyphenyl)-N-(2-morpholin-4-yl-2-naphthalen-1-ylethyl)oxamide |
| SMILES | COc1ccccc1NC(=O)C(=O)NCC(c1cccc2ccccc12)N1CCOCC1 |
| InChI | InChI=1S/C25H27N3O4/c1-31-23-12-5-4-11-21(23)27-25(30)24(29)26-17-22(28-13-15-32-16-14-28)20-10-6-8-18-7-2-3-9-19(18)20/h2-12,22H,13-17H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | NXRFVVZYJKBKPV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|