C26H29N3O2 — CID 41454843
N'-(2,3-dimethylphenyl)-N-[(2S)-2-naphthalen-1-yl-2-pyrrolidin-1-ylethyl]oxamide (PubChem CID 41454843) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is N'-(2,3-dimethylphenyl)-N-[(2S)-2-naphthalen-1-yl-2-pyrrolidin-1-ylethyl]oxamide.
| Compound Name | N'-(2,3-dimethylphenyl)-N-[(2S)-2-naphthalen-1-yl-2-pyrrolidin-1-ylethyl]oxamide |
|---|---|
| PubChem CID | 41454843 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | N'-(2,3-dimethylphenyl)-N-[(2S)-2-naphthalen-1-yl-2-pyrrolidin-1-ylethyl]oxamide |
| SMILES | Cc1cccc(NC(=O)C(=O)NC[C@H](c2cccc3ccccc23)N2CCCC2)c1C |
| InChI | InChI=1S/C26H29N3O2/c1-18-9-7-14-23(19(18)2)28-26(31)25(30)27-17-24(29-15-5-6-16-29)22-13-8-11-20-10-3-4-12-21(20)22/h3-4,7-14,24H,5-6,15-17H2,1-2H3,(H,27,30)(H,28,31)/t24-/m1/s1 |
| InChIKey | BLCUJSWQKZXPPY-XMMPIXPASA-N |
| XLogP | 4.35 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|