C28H28N4O3 — CID 30835743
N'-(2-methylquinolin-4-yl)-N-[(2S)-2-morpholin-4-yl-2-naphthalen-1-ylethyl]oxamide (PubChem CID 30835743) has the molecular formula C28H28N4O3 and a molecular weight of 468.56 g/mol. Its IUPAC name is N'-(2-methylquinolin-4-yl)-N-[(2S)-2-morpholin-4-yl-2-naphthalen-1-ylethyl]oxamide.
| Compound Name | N'-(2-methylquinolin-4-yl)-N-[(2S)-2-morpholin-4-yl-2-naphthalen-1-ylethyl]oxamide |
|---|---|
| PubChem CID | 30835743 |
| Molecular Formula | C28H28N4O3 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | N'-(2-methylquinolin-4-yl)-N-[(2S)-2-morpholin-4-yl-2-naphthalen-1-ylethyl]oxamide |
| SMILES | Cc1cc(NC(=O)C(=O)NC[C@H](c2cccc3ccccc23)N2CCOCC2)c2ccccc2n1 |
| InChI | InChI=1S/C28H28N4O3/c1-19-17-25(23-10-4-5-12-24(23)30-19)31-28(34)27(33)29-18-26(32-13-15-35-16-14-32)22-11-6-8-20-7-2-3-9-21(20)22/h2-12,17,26H,13-16,18H2,1H3,(H,29,33)(H,30,31,34)/t26-/m1/s1 |
| InChIKey | SUJJGUPOKFYOLS-AREMUKBSSA-N |
| XLogP | 3.82 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|