C21H35NO2 — CID 2934641
1-[2-[2-(4-butan-2-ylphenoxy)ethoxy]ethyl]-3,5-dimethylpiperidine (PubChem CID 2934641) has the molecular formula C21H35NO2 and a molecular weight of 333.52 g/mol. Its IUPAC name is 1-[2-[2-(4-butan-2-ylphenoxy)ethoxy]ethyl]-3,5-dimethylpiperidine.
| Compound Name | 1-[2-[2-(4-butan-2-ylphenoxy)ethoxy]ethyl]-3,5-dimethylpiperidine |
|---|---|
| PubChem CID | 2934641 |
| Molecular Formula | C21H35NO2 |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.27 |
| IUPAC Name | 1-[2-[2-(4-butan-2-ylphenoxy)ethoxy]ethyl]-3,5-dimethylpiperidine |
| SMILES | CCC(C)c1ccc(OCCOCCN2CC(C)CC(C)C2)cc1 |
| InChI | InChI=1S/C21H35NO2/c1-5-19(4)20-6-8-21(9-7-20)24-13-12-23-11-10-22-15-17(2)14-18(3)16-22/h6-9,17-19H,5,10-16H2,1-4H3 |
| InChIKey | SWQCGVOTNGYYTN-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|