C12H19N3O3 — CID 2936261
1-(1-ethyl-2,5-dioxopyrrolidin-3-yl)piperidine-4-carboxamide (PubChem CID 2936261) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is 1-(1-ethyl-2,5-dioxopyrrolidin-3-yl)piperidine-4-carboxamide.
| Compound Name | 1-(1-ethyl-2,5-dioxopyrrolidin-3-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 2936261 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 1-(1-ethyl-2,5-dioxopyrrolidin-3-yl)piperidine-4-carboxamide |
| SMILES | CCN1C(=O)CC(N2CCC(C(N)=O)CC2)C1=O |
| InChI | InChI=1S/C12H19N3O3/c1-2-15-10(16)7-9(12(15)18)14-5-3-8(4-6-14)11(13)17/h8-9H,2-7H2,1H3,(H2,13,17) |
| InChIKey | WJQSOAVUYCKQHE-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|