C22H19N5O3S — CID 29367366
N-[4-(furan-2-ylmethylcarbamoylamino)phenyl]-3-phenyl-2-sulfanylidene-1H-imidazole-4-carboxamide (PubChem CID 29367366) has the molecular formula C22H19N5O3S and a molecular weight of 433.49 g/mol. Its IUPAC name is N-[4-(furan-2-ylmethylcarbamoylamino)phenyl]-3-phenyl-2-sulfanylidene-1H-imidazole-4-carboxamide.
| Compound Name | N-[4-(furan-2-ylmethylcarbamoylamino)phenyl]-3-phenyl-2-sulfanylidene-1H-imidazole-4-carboxamide |
|---|---|
| PubChem CID | 29367366 |
| Molecular Formula | C22H19N5O3S |
| Molecular Weight | 433.49 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | N-[4-(furan-2-ylmethylcarbamoylamino)phenyl]-3-phenyl-2-sulfanylidene-1H-imidazole-4-carboxamide |
| SMILES | O=C(NCc1ccco1)Nc1ccc(NC(=O)c2c[nH]c(=S)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H19N5O3S/c28-20(19-14-24-22(31)27(19)17-5-2-1-3-6-17)25-15-8-10-16(11-9-15)26-21(29)23-13-18-7-4-12-30-18/h1-12,14H,13H2,(H,24,31)(H,25,28)(H2,23,26,29) |
| InChIKey | DVZALKARDXDXTL-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 104.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.49 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|