C17H11N5OS — CID 29369713
2-pyridin-3-yl-N-(1,3,4-thiadiazol-2-yl)quinoline-4-carboxamide (PubChem CID 29369713) has the molecular formula C17H11N5OS and a molecular weight of 333.38 g/mol. Its IUPAC name is 2-pyridin-3-yl-N-(1,3,4-thiadiazol-2-yl)quinoline-4-carboxamide.
| Compound Name | 2-pyridin-3-yl-N-(1,3,4-thiadiazol-2-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 29369713 |
| Molecular Formula | C17H11N5OS |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | 2-pyridin-3-yl-N-(1,3,4-thiadiazol-2-yl)quinoline-4-carboxamide |
| SMILES | O=C(Nc1nncs1)c1cc(-c2cccnc2)nc2ccccc12 |
| InChI | InChI=1S/C17H11N5OS/c23-16(21-17-22-19-10-24-17)13-8-15(11-4-3-7-18-9-11)20-14-6-2-1-5-12(13)14/h1-10H,(H,21,22,23) |
| InChIKey | URQYVSBGSNXWOB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |