C24H22N2O5S — CID 29378096
ethyl 4-cyclopropyl-2-[[2-[(E)-3-quinolin-2-ylprop-2-enoyl]oxyacetyl]amino]thiophene-3-carboxylate (PubChem CID 29378096) has the molecular formula C24H22N2O5S and a molecular weight of 450.52 g/mol. Its IUPAC name is ethyl 4-cyclopropyl-2-[[2-[(E)-3-quinolin-2-ylprop-2-enoyl]oxyacetyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-cyclopropyl-2-[[2-[(E)-3-quinolin-2-ylprop-2-enoyl]oxyacetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 29378096 |
| Molecular Formula | C24H22N2O5S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | ethyl 4-cyclopropyl-2-[[2-[(E)-3-quinolin-2-ylprop-2-enoyl]oxyacetyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(C2CC2)csc1NC(=O)COC(=O)/C=C/c1ccc2ccccc2n1 |
| InChI | InChI=1S/C24H22N2O5S/c1-2-30-24(29)22-18(15-7-8-15)14-32-23(22)26-20(27)13-31-21(28)12-11-17-10-9-16-5-3-4-6-19(16)25-17/h3-6,9-12,14-15H,2,7-8,13H2,1H3,(H,26,27)/b12-11+ |
| InChIKey | HWWWHMDDZKADQT-VAWYXSNFSA-N |
| XLogP | 4.55 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|