C17H22N4O2 — CID 2941674
1-[3-(3,5-dimethylpyrazol-1-yl)-4-nitrophenyl]azepane (PubChem CID 2941674) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)-4-nitrophenyl]azepane.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)-4-nitrophenyl]azepane |
|---|---|
| PubChem CID | 2941674 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)-4-nitrophenyl]azepane |
| SMILES | Cc1cc(C)n(-c2cc(N3CCCCCC3)ccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C17H22N4O2/c1-13-11-14(2)20(18-13)17-12-15(7-8-16(17)21(22)23)19-9-5-3-4-6-10-19/h7-8,11-12H,3-6,9-10H2,1-2H3 |
| InChIKey | YXTIUSWPJDGSTG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 64.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|