C25H29N5O3 — CID 3757722
[4-[3-(3,5-dimethylpyrazol-1-yl)-4-nitrophenyl]piperazin-1-yl]-(4-propan-2-ylphenyl)methanone (PubChem CID 3757722) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is [4-[3-(3,5-dimethylpyrazol-1-yl)-4-nitrophenyl]piperazin-1-yl]-(4-propan-2-ylphenyl)methanone.
| Compound Name | [4-[3-(3,5-dimethylpyrazol-1-yl)-4-nitrophenyl]piperazin-1-yl]-(4-propan-2-ylphenyl)methanone |
|---|---|
| PubChem CID | 3757722 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | [4-[3-(3,5-dimethylpyrazol-1-yl)-4-nitrophenyl]piperazin-1-yl]-(4-propan-2-ylphenyl)methanone |
| SMILES | Cc1cc(C)n(-c2cc(N3CCN(C(=O)c4ccc(C(C)C)cc4)CC3)ccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C25H29N5O3/c1-17(2)20-5-7-21(8-6-20)25(31)28-13-11-27(12-14-28)22-9-10-23(30(32)33)24(16-22)29-19(4)15-18(3)26-29/h5-10,15-17H,11-14H2,1-4H3 |
| InChIKey | NXIJTFTZYXPQMZ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|