C13H12FNO4S — CID 2943662
3-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid (PubChem CID 2943662) has the molecular formula C13H12FNO4S and a molecular weight of 297.31 g/mol. Its IUPAC name is 3-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid.
| Compound Name | 3-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 2943662 |
| Molecular Formula | C13H12FNO4S |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 3-[1-(4-fluorophenyl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid |
| SMILES | O=C(O)CCSC1CC(=O)N(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C13H12FNO4S/c14-8-1-3-9(4-2-8)15-11(16)7-10(13(15)19)20-6-5-12(17)18/h1-4,10H,5-7H2,(H,17,18) |
| InChIKey | YSBKYVZIVNGVDB-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|