C30H31N3O3 — CID 29441570
N-[2-(2-phenylethylcarbamoyl)phenyl]-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide (PubChem CID 29441570) has the molecular formula C30H31N3O3 and a molecular weight of 481.60 g/mol. Its IUPAC name is N-[2-(2-phenylethylcarbamoyl)phenyl]-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide.
| Compound Name | N-[2-(2-phenylethylcarbamoyl)phenyl]-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 29441570 |
| Molecular Formula | C30H31N3O3 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | N-[2-(2-phenylethylcarbamoyl)phenyl]-1-[(E)-3-phenylprop-2-enoyl]piperidine-4-carboxamide |
| SMILES | O=C(NCCc1ccccc1)c1ccccc1NC(=O)C1CCN(C(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C30H31N3O3/c34-28(16-15-23-9-3-1-4-10-23)33-21-18-25(19-22-33)29(35)32-27-14-8-7-13-26(27)30(36)31-20-17-24-11-5-2-6-12-24/h1-16,25H,17-22H2,(H,31,36)(H,32,35)/b16-15+ |
| InChIKey | JQGNMFJVKWBGEX-FOCLMDBBSA-N |
| XLogP | 4.55 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|