C23H25N5O2 — CID 30539816
1-[(E)-3-phenylprop-2-enoyl]-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]piperidine-4-carboxamide (PubChem CID 30539816) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is 1-[(E)-3-phenylprop-2-enoyl]-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]piperidine-4-carboxamide.
| Compound Name | 1-[(E)-3-phenylprop-2-enoyl]-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 30539816 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 1-[(E)-3-phenylprop-2-enoyl]-N-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]piperidine-4-carboxamide |
| SMILES | O=C(NCCc1nnc2ccccn12)C1CCN(C(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C23H25N5O2/c29-22(10-9-18-6-2-1-3-7-18)27-16-12-19(13-17-27)23(30)24-14-11-21-26-25-20-8-4-5-15-28(20)21/h1-10,15,19H,11-14,16-17H2,(H,24,30)/b10-9+ |
| InChIKey | YYPRDPMUCPAAGM-MDZDMXLPSA-N |
| XLogP | 2.34 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|