C24H21F3N2O9S — CID 2944925
propan-2-yl 4,4,4-trifluoro-2-[1-hydroxy-4-[(4-methoxy-3-nitrophenyl)sulfonylamino]naphthalen-2-yl]-3-oxobutanoate (PubChem CID 2944925) has the molecular formula C24H21F3N2O9S and a molecular weight of 570.50 g/mol. Its IUPAC name is propan-2-yl 4,4,4-trifluoro-2-[1-hydroxy-4-[(4-methoxy-3-nitrophenyl)sulfonylamino]naphthalen-2-yl]-3-oxobutanoate.
| Compound Name | propan-2-yl 4,4,4-trifluoro-2-[1-hydroxy-4-[(4-methoxy-3-nitrophenyl)sulfonylamino]naphthalen-2-yl]-3-oxobutanoate |
|---|---|
| PubChem CID | 2944925 |
| Molecular Formula | C24H21F3N2O9S |
| Molecular Weight | 570.50 g/mol |
| Exact Mass | 570.09 |
| IUPAC Name | propan-2-yl 4,4,4-trifluoro-2-[1-hydroxy-4-[(4-methoxy-3-nitrophenyl)sulfonylamino]naphthalen-2-yl]-3-oxobutanoate |
| SMILES | COc1ccc(S(=O)(=O)Nc2cc(C(C(=O)OC(C)C)C(=O)C(F)(F)F)c(O)c3ccccc23)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H21F3N2O9S/c1-12(2)38-23(32)20(22(31)24(25,26)27)16-11-17(14-6-4-5-7-15(14)21(16)30)28-39(35,36)13-8-9-19(37-3)18(10-13)29(33)34/h4-12,20,28,30H,1-3H3 |
| InChIKey | RPOAYPCQMNBHMQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 162.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|