C15H13F3N2O5S2 — CID 16962565
4-methoxy-3-nitro-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]benzenesulfonamide (PubChem CID 16962565) has the molecular formula C15H13F3N2O5S2 and a molecular weight of 422.41 g/mol. Its IUPAC name is 4-methoxy-3-nitro-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]benzenesulfonamide.
| Compound Name | 4-methoxy-3-nitro-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 16962565 |
| Molecular Formula | C15H13F3N2O5S2 |
| Molecular Weight | 422.41 g/mol |
| Exact Mass | 422.02 |
| IUPAC Name | 4-methoxy-3-nitro-N-[2-(2,2,2-trifluoroethylsulfanyl)phenyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccccc2SCC(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H13F3N2O5S2/c1-25-13-7-6-10(8-12(13)20(21)22)27(23,24)19-11-4-2-3-5-14(11)26-9-15(16,17)18/h2-8,19H,9H2,1H3 |
| InChIKey | LUBOBTMYPBJOTD-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|