C28H28N4O4 — CID 2946286
N-[5-(4-methoxyphthalazin-1-yl)-2-morpholin-4-ylphenyl]-2-(3-methylphenoxy)acetamide (PubChem CID 2946286) has the molecular formula C28H28N4O4 and a molecular weight of 484.56 g/mol. Its IUPAC name is N-[5-(4-methoxyphthalazin-1-yl)-2-morpholin-4-ylphenyl]-2-(3-methylphenoxy)acetamide.
| Compound Name | N-[5-(4-methoxyphthalazin-1-yl)-2-morpholin-4-ylphenyl]-2-(3-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 2946286 |
| Molecular Formula | C28H28N4O4 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | N-[5-(4-methoxyphthalazin-1-yl)-2-morpholin-4-ylphenyl]-2-(3-methylphenoxy)acetamide |
| SMILES | COc1nnc(-c2ccc(N3CCOCC3)c(NC(=O)COc3cccc(C)c3)c2)c2ccccc12 |
| InChI | InChI=1S/C28H28N4O4/c1-19-6-5-7-21(16-19)36-18-26(33)29-24-17-20(10-11-25(24)32-12-14-35-15-13-32)27-22-8-3-4-9-23(22)28(34-2)31-30-27/h3-11,16-17H,12-15,18H2,1-2H3,(H,29,33) |
| InChIKey | WCCZDIANBCYGJT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |