C20H25ClN3O2+ — CID 7551877
N-[5-chloro-2-(4-methylpiperazin-4-ium-1-yl)phenyl]-2-(3-methylphenoxy)acetamide (PubChem CID 7551877) has the molecular formula C20H25ClN3O2+ and a molecular weight of 374.89 g/mol. Its IUPAC name is N-[5-chloro-2-(4-methylpiperazin-4-ium-1-yl)phenyl]-2-(3-methylphenoxy)acetamide.
| Compound Name | N-[5-chloro-2-(4-methylpiperazin-4-ium-1-yl)phenyl]-2-(3-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 7551877 |
| Molecular Formula | C20H25ClN3O2+ |
| Molecular Weight | 374.89 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | N-[5-chloro-2-(4-methylpiperazin-4-ium-1-yl)phenyl]-2-(3-methylphenoxy)acetamide |
| SMILES | Cc1cccc(OCC(=O)Nc2cc(Cl)ccc2N2CC[NH+](C)CC2)c1 |
| InChI | InChI=1S/C20H24ClN3O2/c1-15-4-3-5-17(12-15)26-14-20(25)22-18-13-16(21)6-7-19(18)24-10-8-23(2)9-11-24/h3-7,12-13H,8-11,14H2,1-2H3,(H,22,25)/p+1 |
| InChIKey | PVXWCJLQNNCCCA-UHFFFAOYSA-O |
| XLogP | 2.00 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.89 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |