C22H28N3O5+ — CID 7092448
methyl 3-[[2-(4-methoxyphenoxy)acetyl]amino]-4-(4-methylpiperazin-4-ium-1-yl)benzoate (PubChem CID 7092448) has the molecular formula C22H28N3O5+ and a molecular weight of 414.48 g/mol. Its IUPAC name is methyl 3-[[2-(4-methoxyphenoxy)acetyl]amino]-4-(4-methylpiperazin-4-ium-1-yl)benzoate.
| Compound Name | methyl 3-[[2-(4-methoxyphenoxy)acetyl]amino]-4-(4-methylpiperazin-4-ium-1-yl)benzoate |
|---|---|
| PubChem CID | 7092448 |
| Molecular Formula | C22H28N3O5+ |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | methyl 3-[[2-(4-methoxyphenoxy)acetyl]amino]-4-(4-methylpiperazin-4-ium-1-yl)benzoate |
| SMILES | COC(=O)c1ccc(N2CC[NH+](C)CC2)c(NC(=O)COc2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C22H27N3O5/c1-24-10-12-25(13-11-24)20-9-4-16(22(27)29-3)14-19(20)23-21(26)15-30-18-7-5-17(28-2)6-8-18/h4-9,14H,10-13,15H2,1-3H3,(H,23,26)/p+1 |
| InChIKey | VQQGQOFJSQIRDD-UHFFFAOYSA-O |
| XLogP | 0.83 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |