C20H18F3N5O3S — CID 2946359
N-(3-carbamoyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 2946359) has the molecular formula C20H18F3N5O3S and a molecular weight of 465.46 g/mol. Its IUPAC name is N-(3-carbamoyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | N-(3-carbamoyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 2946359 |
| Molecular Formula | C20H18F3N5O3S |
| Molecular Weight | 465.46 g/mol |
| Exact Mass | 465.11 |
| IUPAC Name | N-(3-carbamoyl-5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)-5-(furan-2-yl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | NC(=O)c1c(NC(=O)c2cc3n(n2)C(C(F)(F)F)CC(c2ccco2)N3)sc2c1CCC2 |
| InChI | InChI=1S/C20H18F3N5O3S/c21-20(22,23)14-7-10(12-4-2-6-31-12)25-15-8-11(27-28(14)15)18(30)26-19-16(17(24)29)9-3-1-5-13(9)32-19/h2,4,6,8,10,14,25H,1,3,5,7H2,(H2,24,29)(H,26,30) |
| InChIKey | NCNIWAPIKKFPGN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 115.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |