C18H19F2N3O5S — CID 29467271
2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-N-[[2-(dimethylsulfamoyl)phenyl]methyl]acetamide (PubChem CID 29467271) has the molecular formula C18H19F2N3O5S and a molecular weight of 427.43 g/mol. Its IUPAC name is 2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-N-[[2-(dimethylsulfamoyl)phenyl]methyl]acetamide.
| Compound Name | 2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-N-[[2-(dimethylsulfamoyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 29467271 |
| Molecular Formula | C18H19F2N3O5S |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | 2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-N-[[2-(dimethylsulfamoyl)phenyl]methyl]acetamide |
| SMILES | CN(C)S(=O)(=O)c1ccccc1CNC(=O)CNc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C18H19F2N3O5S/c1-23(2)29(25,26)16-6-4-3-5-12(16)10-22-17(24)11-21-13-7-8-14-15(9-13)28-18(19,20)27-14/h3-9,21H,10-11H2,1-2H3,(H,22,24) |
| InChIKey | WTTHFHNTLJGANI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|