C15H17FN2O4 — CID 29469200
N-(dicyclopropylmethyl)-2-(5-fluoro-2-nitrophenoxy)acetamide (PubChem CID 29469200) has the molecular formula C15H17FN2O4 and a molecular weight of 308.31 g/mol. Its IUPAC name is N-(dicyclopropylmethyl)-2-(5-fluoro-2-nitrophenoxy)acetamide.
| Compound Name | N-(dicyclopropylmethyl)-2-(5-fluoro-2-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 29469200 |
| Molecular Formula | C15H17FN2O4 |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | N-(dicyclopropylmethyl)-2-(5-fluoro-2-nitrophenoxy)acetamide |
| SMILES | O=C(COc1cc(F)ccc1[N+](=O)[O-])NC(C1CC1)C1CC1 |
| InChI | InChI=1S/C15H17FN2O4/c16-11-5-6-12(18(20)21)13(7-11)22-8-14(19)17-15(9-1-2-9)10-3-4-10/h5-7,9-10,15H,1-4,8H2,(H,17,19) |
| InChIKey | VGTSFILZCVHTTE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|