C24H25IN2O5S — CID 2947496
ethyl 2-[4-(5-acetyl-6-phenyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-4-yl)-2-ethoxy-6-iodophenoxy]acetate (PubChem CID 2947496) has the molecular formula C24H25IN2O5S and a molecular weight of 580.44 g/mol. Its IUPAC name is ethyl 2-[4-(5-acetyl-6-phenyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-4-yl)-2-ethoxy-6-iodophenoxy]acetate.
| Compound Name | ethyl 2-[4-(5-acetyl-6-phenyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-4-yl)-2-ethoxy-6-iodophenoxy]acetate |
|---|---|
| PubChem CID | 2947496 |
| Molecular Formula | C24H25IN2O5S |
| Molecular Weight | 580.44 g/mol |
| Exact Mass | 580.05 |
| IUPAC Name | ethyl 2-[4-(5-acetyl-6-phenyl-2-sulfanylidene-3,4-dihydro-1H-pyrimidin-4-yl)-2-ethoxy-6-iodophenoxy]acetate |
| SMILES | CCOC(=O)COc1c(I)cc(C2NC(=S)NC(c3ccccc3)=C2C(C)=O)cc1OCC |
| InChI | InChI=1S/C24H25IN2O5S/c1-4-30-18-12-16(11-17(25)23(18)32-13-19(29)31-5-2)22-20(14(3)28)21(26-24(33)27-22)15-9-7-6-8-10-15/h6-12,22H,4-5,13H2,1-3H3,(H2,26,27,33) |
| InChIKey | WVXIKFMMEFHBAL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|